C21H36O6 — CID 70873020
(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-(3,7,11-trimethyldodec-2-enoxy)-2H-furan-5-one (PubChem CID 70873020) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-(3,7,11-trimethyldodec-2-enoxy)-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-(3,7,11-trimethyldodec-2-enoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 70873020 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-(3,7,11-trimethyldodec-2-enoxy)-2H-furan-5-one |
| SMILES | CC(=CCOC1=C(O)C(=O)O[C@@H]1[C@@H](O)CO)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C21H36O6/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-26-20-18(24)21(25)27-19(20)17(23)13-22/h11,14-15,17,19,22-24H,5-10,12-13H2,1-4H3/t15?,17-,19+/m0/s1 |
| InChIKey | FWZWKCWYAXRVJZ-IYSUZNMVSA-N |
| XLogP | 3.63 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|