C37H47N3O4Si — CID 70902351
tert-butyl N-[(2R)-1-[4-(2-acetyl-1-methylimidazol-4-yl)phenyl]-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate (PubChem CID 70902351) has the molecular formula C37H47N3O4Si and a molecular weight of 625.89 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[4-(2-acetyl-1-methylimidazol-4-yl)phenyl]-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[4-(2-acetyl-1-methylimidazol-4-yl)phenyl]-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70902351 |
| Molecular Formula | C37H47N3O4Si |
| Molecular Weight | 625.89 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | tert-butyl N-[(2R)-1-[4-(2-acetyl-1-methylimidazol-4-yl)phenyl]-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate |
| SMILES | CC(=O)c1nc(-c2ccc(C[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)NC(=O)OC(C)(C)C)cc2)cn1C |
| InChI | InChI=1S/C37H47N3O4Si/c1-27(41)34-39-33(26-40(34)8)29-21-19-28(20-22-29)25-30(38-35(42)44-36(2,3)4)23-24-43-45(37(5,6)7,31-15-11-9-12-16-31)32-17-13-10-14-18-32/h9-22,26,30H,23-25H2,1-8H3,(H,38,42)/t30-/m0/s1 |
| InChIKey | FQCJDNINMUNTGC-PMERELPUSA-N |
| XLogP | 6.69 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.89 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|