C34H44N2O2Si — CID 58970284
(2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[4-(2-tert-butyl-1-methylimidazol-4-yl)phenyl]butan-2-ol (PubChem CID 58970284) has the molecular formula C34H44N2O2Si and a molecular weight of 540.82 g/mol. Its IUPAC name is (2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[4-(2-tert-butyl-1-methylimidazol-4-yl)phenyl]butan-2-ol.
| Compound Name | (2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[4-(2-tert-butyl-1-methylimidazol-4-yl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 58970284 |
| Molecular Formula | C34H44N2O2Si |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | (2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[4-(2-tert-butyl-1-methylimidazol-4-yl)phenyl]butan-2-ol |
| SMILES | Cn1cc(-c2ccc(C[C@H](O)CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc2)nc1C(C)(C)C |
| InChI | InChI=1S/C34H44N2O2Si/c1-33(2,3)32-35-31(25-36(32)7)27-20-18-26(19-21-27)24-28(37)22-23-38-39(34(4,5)6,29-14-10-8-11-15-29)30-16-12-9-13-17-30/h8-21,25,28,37H,22-24H2,1-7H3/t28-/m1/s1 |
| InChIKey | ZZMIMAJPLOHMDH-MUUNZHRXSA-N |
| XLogP | 6.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|