About 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene
2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene (PubChem CID 70903705) has the molecular formula C14H10S4
and a molecular weight of 306.50 g/mol. Its IUPAC name is 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene |
| PubChem CID | 70903705 |
| Molecular Formula | C14H10S4 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene |
| SMILES | C1=CSC(c2cc3sc(-c4cccs4)cc3s2)C1 |
| InChI | InChI=1S/C14H10S4/c1-3-9(15-5-1)11-7-13-14(17-11)8-12(18-13)10-4-2-6-16-10/h1-3,5-8,10H,4H2 |
| InChIKey | YZVMJTZGGUKJMA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene?
The IUPAC name of 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene (CID 70903705) is 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene.
What is the SMILES notation for 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene?
The canonical SMILES for 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene is C1=CSC(c2cc3sc(-c4cccs4)cc3s2)C1.
What is the InChIKey of 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene?
The InChIKey is YZVMJTZGGUKJMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10S4/c1-3-9(15-5-1)11-7-13-14(17-11)8-12(18-13)10-4-2-6-16-10/h1-3,5-8,10H,4H2.
What are the key properties of 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene?
2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene has a molecular weight of 306.50 g/mol, XLogP of 6.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydrothiophen-2-yl)-5-thiophen-2-ylthieno[3,2-b]thiophene is sourced from PubChem (CID 70903705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).