C31H37N5O2 — CID 70910967
2-(2-tert-butyl-2,3-dihydroindolizin-3-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide (PubChem CID 70910967) has the molecular formula C31H37N5O2 and a molecular weight of 511.67 g/mol. Its IUPAC name is 2-(2-tert-butyl-2,3-dihydroindolizin-3-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide.
| Compound Name | 2-(2-tert-butyl-2,3-dihydroindolizin-3-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 70910967 |
| Molecular Formula | C31H37N5O2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 2-(2-tert-butyl-2,3-dihydroindolizin-3-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
| SMILES | Cc1cc(C)nc(N2CCN(c3ccc(NC(=O)C(=O)C4C(C(C)(C)C)C=C5C=CC=CN54)cc3)CC2)c1 |
| InChI | InChI=1S/C31H37N5O2/c1-21-18-22(2)32-27(19-21)35-16-14-34(15-17-35)24-11-9-23(10-12-24)33-30(38)29(37)28-26(31(3,4)5)20-25-8-6-7-13-36(25)28/h6-13,18-20,26,28H,14-17H2,1-5H3,(H,33,38) |
| InChIKey | LAVZRSZROJKXKW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|