C26H25N5O4 — CID 70944166
3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1-methyl-1-(1-methylisoquinolin-6-yl)urea (PubChem CID 70944166) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1-methyl-1-(1-methylisoquinolin-6-yl)urea.
| Compound Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1-methyl-1-(1-methylisoquinolin-6-yl)urea |
|---|---|
| PubChem CID | 70944166 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-1-methyl-1-(1-methylisoquinolin-6-yl)urea |
| SMILES | Cc1nccc2cc(N(C)C(=O)NCc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)ccc12 |
| InChI | InChI=1S/C26H25N5O4/c1-15-20-6-4-19(12-17(20)9-10-27-15)30(2)26(35)28-13-16-3-5-21-18(11-16)14-31(25(21)34)22-7-8-23(32)29-24(22)33/h3-6,9-12,22H,7-8,13-14H2,1-2H3,(H,28,35)(H,29,32,33) |
| InChIKey | CLMGKGBBTGVSGJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|