C16H30N2O8 — CID 70994853
[4-acetyloxy-5-amino-6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 70994853) has the molecular formula C16H30N2O8 and a molecular weight of 378.42 g/mol. Its IUPAC name is [4-acetyloxy-5-amino-6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [4-acetyloxy-5-amino-6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70994853 |
| Molecular Formula | C16H30N2O8 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [4-acetyloxy-5-amino-6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CC(OC(C)=O)C(N)C(OCCOCCOCCN)O1 |
| InChI | InChI=1S/C16H30N2O8/c1-11(19)24-10-13-9-14(25-12(2)20)15(18)16(26-13)23-8-7-22-6-5-21-4-3-17/h13-16H,3-10,17-18H2,1-2H3 |
| InChIKey | JLNYVCWMBHEJKS-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 141.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|