C19H22O5S2 — CID 71057745
(3R,5S,6R)-2-[5-(1-benzothiophen-6-ylmethyl)-2,3-dihydrothiophen-3-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71057745) has the molecular formula C19H22O5S2 and a molecular weight of 394.51 g/mol. Its IUPAC name is (3R,5S,6R)-2-[5-(1-benzothiophen-6-ylmethyl)-2,3-dihydrothiophen-3-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,5S,6R)-2-[5-(1-benzothiophen-6-ylmethyl)-2,3-dihydrothiophen-3-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71057745 |
| Molecular Formula | C19H22O5S2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (3R,5S,6R)-2-[5-(1-benzothiophen-6-ylmethyl)-2,3-dihydrothiophen-3-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(C2C=C(Cc3ccc4ccsc4c3)SC2)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C19H22O5S2/c20-8-14-16(21)17(22)18(23)19(24-14)12-7-13(26-9-12)5-10-1-2-11-3-4-25-15(11)6-10/h1-4,6-7,12,14,16-23H,5,8-9H2/t12?,14-,16-,17?,18-,19?/m1/s1 |
| InChIKey | JEURXYCUJQDKQL-ZBUXJKOQSA-N |
| XLogP | 1.53 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |