C20H32O2S — CID 71098204
ethyl 7-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-methylsulfanylheptanoate (PubChem CID 71098204) has the molecular formula C20H32O2S and a molecular weight of 336.54 g/mol. Its IUPAC name is ethyl 7-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-methylsulfanylheptanoate.
| Compound Name | ethyl 7-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-methylsulfanylheptanoate |
|---|---|
| PubChem CID | 71098204 |
| Molecular Formula | C20H32O2S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | ethyl 7-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-methylsulfanylheptanoate |
| SMILES | CC/C=C\C1(CCCCCC(SC)C(=O)OCC)C=CCC=C1 |
| InChI | InChI=1S/C20H32O2S/c1-4-6-14-20(16-11-8-12-17-20)15-10-7-9-13-18(23-3)19(21)22-5-2/h6,11-12,14,16-18H,4-5,7-10,13,15H2,1-3H3/b14-6- |
| InChIKey | JEYAVQDVYVATDG-NSIKDUERSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|