C30H35N3O2 — CID 71124058
4-[1-(2-ethylhexyl)-2,6-dimethyl-4-pyridinylidene]-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 71124058) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 4-[1-(2-ethylhexyl)-2,6-dimethyl-4-pyridinylidene]-1,2-diphenylpyrazolidine-3,5-dione.
| Compound Name | 4-[1-(2-ethylhexyl)-2,6-dimethyl-4-pyridinylidene]-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 71124058 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 4-[1-(2-ethylhexyl)-2,6-dimethyl-4-pyridinylidene]-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | CCCCC(CC)CN1C(C)=CC(=C2C(=O)N(c3ccccc3)N(c3ccccc3)C2=O)C=C1C |
| InChI | InChI=1S/C30H35N3O2/c1-5-7-14-24(6-2)21-31-22(3)19-25(20-23(31)4)28-29(34)32(26-15-10-8-11-16-26)33(30(28)35)27-17-12-9-13-18-27/h8-13,15-20,24H,5-7,14,21H2,1-4H3 |
| InChIKey | LCPSVUQCDXOWPD-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|