C26H38N2O4S — CID 71127878
(1R,2S,6S,8Z,13R,14R,15S)-2,14-dihydroxy-1,9,15-trimethyl-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione (PubChem CID 71127878) has the molecular formula C26H38N2O4S and a molecular weight of 474.67 g/mol. Its IUPAC name is (1R,2S,6S,8Z,13R,14R,15S)-2,14-dihydroxy-1,9,15-trimethyl-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione.
| Compound Name | (1R,2S,6S,8Z,13R,14R,15S)-2,14-dihydroxy-1,9,15-trimethyl-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione |
|---|---|
| PubChem CID | 71127878 |
| Molecular Formula | C26H38N2O4S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (1R,2S,6S,8Z,13R,14R,15S)-2,14-dihydroxy-1,9,15-trimethyl-6-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5-azabicyclo[11.3.1]heptadec-8-ene-4,16-dione |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2csc(C)n2)NC(=O)C[C@H](O)[C@@]2(C)C[C@@H](CCC1)[C@@H](O)[C@H](C)C2=O |
| InChI | InChI=1S/C26H38N2O4S/c1-15-7-6-8-19-13-26(5,25(32)17(3)24(19)31)22(29)12-23(30)28-21(10-9-15)16(2)11-20-14-33-18(4)27-20/h9,11,14,17,19,21-22,24,29,31H,6-8,10,12-13H2,1-5H3,(H,28,30)/b15-9-,16-11+/t17-,19+,21-,22-,24-,26+/m0/s1 |
| InChIKey | VIJWZEKIYWWJRC-SECJRJMCSA-N |
| XLogP | 4.20 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|