C28H29F3N4O7 — CID 71136132
methyl 2-[cyclopropyl-[4-[[[3-(trifluoromethoxy)benzoyl]amino]carbamoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]carbamoyl]oxyacetate (PubChem CID 71136132) has the molecular formula C28H29F3N4O7 and a molecular weight of 590.56 g/mol. Its IUPAC name is methyl 2-[cyclopropyl-[4-[[[3-(trifluoromethoxy)benzoyl]amino]carbamoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]carbamoyl]oxyacetate.
| Compound Name | methyl 2-[cyclopropyl-[4-[[[3-(trifluoromethoxy)benzoyl]amino]carbamoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]carbamoyl]oxyacetate |
|---|---|
| PubChem CID | 71136132 |
| Molecular Formula | C28H29F3N4O7 |
| Molecular Weight | 590.56 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | methyl 2-[cyclopropyl-[4-[[[3-(trifluoromethoxy)benzoyl]amino]carbamoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]carbamoyl]oxyacetate |
| SMILES | COC(=O)COC(=O)N(C1CC1)C1c2ccccc2N(C(=O)NNC(=O)c2cccc(OC(F)(F)F)c2)C2CCCC21 |
| InChI | InChI=1S/C28H29F3N4O7/c1-40-23(36)15-41-27(39)34(17-12-13-17)24-19-8-2-3-10-21(19)35(22-11-5-9-20(22)24)26(38)33-32-25(37)16-6-4-7-18(14-16)42-28(29,30)31/h2-4,6-8,10,14,17,20,22,24H,5,9,11-13,15H2,1H3,(H,32,37)(H,33,38) |
| InChIKey | PJTUEIBDOKLIPY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|