C27H27N7O5 — CID 71158367
1-[2-[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl]-5-benzyl-3-phenylimidazolidine-2,4-dione (PubChem CID 71158367) has the molecular formula C27H27N7O5 and a molecular weight of 529.56 g/mol. Its IUPAC name is 1-[2-[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl]-5-benzyl-3-phenylimidazolidine-2,4-dione.
| Compound Name | 1-[2-[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl]-5-benzyl-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71158367 |
| Molecular Formula | C27H27N7O5 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 1-[2-[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl]-5-benzyl-3-phenylimidazolidine-2,4-dione |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CCN2C(=O)N(c3ccccc3)C(=O)C2Cc2ccccc2)[C@@H](O)C1O |
| InChI | InChI=1S/C27H27N7O5/c28-23-20-24(30-14-29-23)33(15-31-20)26-22(36)21(35)19(39-26)11-12-32-18(13-16-7-3-1-4-8-16)25(37)34(27(32)38)17-9-5-2-6-10-17/h1-10,14-15,18-19,21-22,26,35-36H,11-13H2,(H2,28,29,30)/t18?,19-,21-,22?,26-/m1/s1 |
| InChIKey | JVWNTSKOKPAAHK-NWOMZDSVSA-N |
| XLogP | 1.50 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|