C24H36O4S — CID 71163295
2-[(Z)-4-[2-hydroxy-5-[4-(1-hydroxyheptyl)phenyl]cyclopentyl]but-2-enyl]sulfanylacetic acid (PubChem CID 71163295) has the molecular formula C24H36O4S and a molecular weight of 420.62 g/mol. Its IUPAC name is 2-[(Z)-4-[2-hydroxy-5-[4-(1-hydroxyheptyl)phenyl]cyclopentyl]but-2-enyl]sulfanylacetic acid.
| Compound Name | 2-[(Z)-4-[2-hydroxy-5-[4-(1-hydroxyheptyl)phenyl]cyclopentyl]but-2-enyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 71163295 |
| Molecular Formula | C24H36O4S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-[(Z)-4-[2-hydroxy-5-[4-(1-hydroxyheptyl)phenyl]cyclopentyl]but-2-enyl]sulfanylacetic acid |
| SMILES | CCCCCCC(O)c1ccc(C2CCC(O)C2C/C=C\CSCC(=O)O)cc1 |
| InChI | InChI=1S/C24H36O4S/c1-2-3-4-5-9-22(25)19-12-10-18(11-13-19)20-14-15-23(26)21(20)8-6-7-16-29-17-24(27)28/h6-7,10-13,20-23,25-26H,2-5,8-9,14-17H2,1H3,(H,27,28)/b7-6- |
| InChIKey | RBPGFJHEMSKOAE-SREVYHEPSA-N |
| XLogP | 5.31 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|