C16H26O3Si — CID 71170874
hydroxy-dimethyl-[2-methyl-1-(2-phenyl-1,3-dioxan-5-yl)propan-2-yl]silane (PubChem CID 71170874) has the molecular formula C16H26O3Si and a molecular weight of 294.47 g/mol. Its IUPAC name is hydroxy-dimethyl-[2-methyl-1-(2-phenyl-1,3-dioxan-5-yl)propan-2-yl]silane.
| Compound Name | hydroxy-dimethyl-[2-methyl-1-(2-phenyl-1,3-dioxan-5-yl)propan-2-yl]silane |
|---|---|
| PubChem CID | 71170874 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | hydroxy-dimethyl-[2-methyl-1-(2-phenyl-1,3-dioxan-5-yl)propan-2-yl]silane |
| SMILES | CC(C)(CC1COC(c2ccccc2)OC1)[Si](C)(C)O |
| InChI | InChI=1S/C16H26O3Si/c1-16(2,20(3,4)17)10-13-11-18-15(19-12-13)14-8-6-5-7-9-14/h5-9,13,15,17H,10-12H2,1-4H3 |
| InChIKey | SSQRHUFTHQMLDH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|