C3H4N3O4S3- — CID 71189131
2-methylsulfonyl-5-(sulfinatoamino)-1,3,4-thiadiazole (PubChem CID 71189131) has the molecular formula C3H4N3O4S3- and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-methylsulfonyl-5-(sulfinatoamino)-1,3,4-thiadiazole.
| Compound Name | 2-methylsulfonyl-5-(sulfinatoamino)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 71189131 |
| Molecular Formula | C3H4N3O4S3- |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 241.94 |
| IUPAC Name | 2-methylsulfonyl-5-(sulfinatoamino)-1,3,4-thiadiazole |
| SMILES | CS(=O)(=O)c1nnc(NS(=O)[O-])s1 |
| InChI | InChI=1S/C3H5N3O4S3/c1-13(9,10)3-5-4-2(11-3)6-12(7)8/h1H3,(H,4,6)(H,7,8)/p-1 |
| InChIKey | OXZIPDKTPNDQKX-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|