C6H9ClN4O3S2 — CID 71385879
1-(2-chloroethyl)-3-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 71385879) has the molecular formula C6H9ClN4O3S2 and a molecular weight of 284.75 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(2-chloroethyl)-3-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 71385879 |
| Molecular Formula | C6H9ClN4O3S2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 1-(2-chloroethyl)-3-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CS(=O)(=O)c1nnc(NC(=O)NCCCl)s1 |
| InChI | InChI=1S/C6H9ClN4O3S2/c1-16(13,14)6-11-10-5(15-6)9-4(12)8-3-2-7/h2-3H2,1H3,(H2,8,9,10,12) |
| InChIKey | GQIPVUDILXVTDJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|