C35H45FN8O2Si — CID 71208088
4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]-N-[(1S)-1-cyclohexylethyl]-2-fluorobenzamide (PubChem CID 71208088) has the molecular formula C35H45FN8O2Si and a molecular weight of 656.88 g/mol. Its IUPAC name is 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]-N-[(1S)-1-cyclohexylethyl]-2-fluorobenzamide.
| Compound Name | 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]-N-[(1S)-1-cyclohexylethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 71208088 |
| Molecular Formula | C35H45FN8O2Si |
| Molecular Weight | 656.88 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]-N-[(1S)-1-cyclohexylethyl]-2-fluorobenzamide |
| SMILES | C[C@H](NC(=O)c1ccc(N2CC(CC#N)(n3cc(-c4ncnc5c4ccn5COCC[Si](C)(C)C)cn3)C2)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C35H45FN8O2Si/c1-25(26-8-6-5-7-9-26)41-34(45)29-11-10-28(18-31(29)36)43-21-35(22-43,13-14-37)44-20-27(19-40-44)32-30-12-15-42(33(30)39-23-38-32)24-46-16-17-47(2,3)4/h10-12,15,18-20,23,25-26H,5-9,13,16-17,21-22,24H2,1-4H3,(H,41,45)/t25-/m0/s1 |
| InChIKey | ZVKBQHRKLIQMMJ-VWLOTQADSA-N |
| XLogP | 6.57 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.88 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|