C26H24FN3O3S — CID 71289984
2-(4-ethylsulfonylphenyl)-N-[4-(2-fluorophenyl)-3-(2-methylpyrazol-3-yl)phenyl]acetamide (PubChem CID 71289984) has the molecular formula C26H24FN3O3S and a molecular weight of 477.56 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[4-(2-fluorophenyl)-3-(2-methylpyrazol-3-yl)phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[4-(2-fluorophenyl)-3-(2-methylpyrazol-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 71289984 |
| Molecular Formula | C26H24FN3O3S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[4-(2-fluorophenyl)-3-(2-methylpyrazol-3-yl)phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-c3ccccc3F)c(-c3ccnn3C)c2)cc1 |
| InChI | InChI=1S/C26H24FN3O3S/c1-3-34(32,33)20-11-8-18(9-12-20)16-26(31)29-19-10-13-21(22-6-4-5-7-24(22)27)23(17-19)25-14-15-28-30(25)2/h4-15,17H,3,16H2,1-2H3,(H,29,31) |
| InChIKey | QKEIZBMVHCAQAZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |