About triethyl(propyl)azanium perchlorate
triethyl(propyl)azanium perchlorate (PubChem CID 71332093) has the molecular formula C9H22ClNO4
and a molecular weight of 243.73 g/mol. Its IUPAC name is triethyl(propyl)azanium perchlorate.
Molecular Properties
| Compound Name | triethyl(propyl)azanium perchlorate |
| PubChem CID | 71332093 |
| Molecular Formula | C9H22ClNO4 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | triethyl(propyl)azanium perchlorate |
| SMILES | CCC[N+](CC)(CC)CC.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C9H22N.ClHO4/c1-5-9-10(6-2,7-3)8-4;2-1(3,4)5/h5-9H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | JZGLWTZVDHCKKH-UHFFFAOYSA-M |
| XLogP | -2.48 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl(propyl)azanium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(propyl)azanium perchlorate?
The IUPAC name of triethyl(propyl)azanium perchlorate (CID 71332093) is triethyl(propyl)azanium perchlorate.
What is the SMILES notation for triethyl(propyl)azanium perchlorate?
The canonical SMILES for triethyl(propyl)azanium perchlorate is CCC[N+](CC)(CC)CC.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of triethyl(propyl)azanium perchlorate?
The InChIKey is JZGLWTZVDHCKKH-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H22N.ClHO4/c1-5-9-10(6-2,7-3)8-4;2-1(3,4)5/h5-9H2,1-4H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of triethyl(propyl)azanium perchlorate?
triethyl(propyl)azanium perchlorate has a molecular weight of 243.73 g/mol, XLogP of -2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(propyl)azanium perchlorate is sourced from PubChem (CID 71332093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).