About CID 71417320
CID 71417320 (PubChem CID 71417320) has the molecular formula C27H30O2Sn2
and a molecular weight of 623.96 g/mol.
Molecular Properties
| Compound Name | CID 71417320 |
| PubChem CID | 71417320 |
| Molecular Formula | C27H30O2Sn2 |
| Molecular Weight | 623.96 g/mol |
| Exact Mass | 626.03 |
| IUPAC Name | — |
| SMILES | O.O.c1ccc([Sn](CCC[Sn](c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/4C6H5.C3H6.2H2O.2Sn/c4*1-2-4-6-5-3-1;1-3-2;;;;/h4*1-5H;1-3H2;2*1H2;; |
| InChIKey | SVIDNKGMGHANIS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 623.96 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 71417320 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71417320?
The IUPAC name of CID 71417320 (CID 71417320) is not available.
What is the SMILES notation for CID 71417320?
The canonical SMILES for CID 71417320 is O.O.c1ccc([Sn](CCC[Sn](c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 71417320?
The InChIKey is SVIDNKGMGHANIS-UHFFFAOYSA-N. The full InChI is InChI=1S/4C6H5.C3H6.2H2O.2Sn/c4*1-2-4-6-5-3-1;1-3-2;;;;/h4*1-5H;1-3H2;2*1H2;;.
What are the key properties of CID 71417320?
CID 71417320 has a molecular weight of 623.96 g/mol, XLogP of 2.35, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71417320 is sourced from PubChem (CID 71417320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).