About CID 13240527
CID 13240527 (PubChem CID 13240527) has the molecular formula C30H32Li2Sn2
and a molecular weight of 643.89 g/mol.
Molecular Properties
| Compound Name | CID 13240527 |
| PubChem CID | 13240527 |
| Molecular Formula | C30H32Li2Sn2 |
| Molecular Weight | 643.89 g/mol |
| Exact Mass | 646.09 |
| IUPAC Name | — |
| SMILES | [Li].[Li].c1ccc([Sn](CCCCCC[Sn](c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/4C6H5.C6H12.2Li.2Sn/c4*1-2-4-6-5-3-1;1-3-5-6-4-2;;;;/h4*1-5H;1-6H2;;;; |
| InChIKey | ULWQGAHIJKZDJC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 643.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 13240527 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13240527?
The IUPAC name of CID 13240527 (CID 13240527) is not available.
What is the SMILES notation for CID 13240527?
The canonical SMILES for CID 13240527 is [Li].[Li].c1ccc([Sn](CCCCCC[Sn](c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 13240527?
The InChIKey is ULWQGAHIJKZDJC-UHFFFAOYSA-N. The full InChI is InChI=1S/4C6H5.C6H12.2Li.2Sn/c4*1-2-4-6-5-3-1;1-3-5-6-4-2;;;;/h4*1-5H;1-6H2;;;;.
What are the key properties of CID 13240527?
CID 13240527 has a molecular weight of 643.89 g/mol, XLogP of 4.40, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13240527 is sourced from PubChem (CID 13240527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).