C15H13NO3S — CID 71420158
4-(4-methylphenyl)sulfonyl-1,4-benzoxazine (PubChem CID 71420158) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-1,4-benzoxazine.
| Compound Name | 4-(4-methylphenyl)sulfonyl-1,4-benzoxazine |
|---|---|
| PubChem CID | 71420158 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-1,4-benzoxazine |
| SMILES | Cc1ccc(S(=O)(=O)N2C=COc3ccccc32)cc1 |
| InChI | InChI=1S/C15H13NO3S/c1-12-6-8-13(9-7-12)20(17,18)16-10-11-19-15-5-3-2-4-14(15)16/h2-11H,1H3 |
| InChIKey | RNVYYOIKIAJSQP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |