C4HF6N3S — CID 71422538
3,4-bis(trifluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 71422538) has the molecular formula C4HF6N3S and a molecular weight of 237.13 g/mol. Its IUPAC name is 3,4-bis(trifluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3,4-bis(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 71422538 |
| Molecular Formula | C4HF6N3S |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | 3,4-bis(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)(F)c1n[nH]c(=S)n1C(F)(F)F |
| InChI | InChI=1S/C4HF6N3S/c5-3(6,7)1-11-12-2(14)13(1)4(8,9)10/h(H,12,14) |
| InChIKey | WCALFOXBMRLCME-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|