C38H41N3O11 — CID 71434931
2-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[4-(2-methylpropanoylamino)-2-oxopyrimidin-1-yl]oxolan-3-yl]oxybutanedioic acid (PubChem CID 71434931) has the molecular formula C38H41N3O11 and a molecular weight of 715.76 g/mol. Its IUPAC name is 2-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[4-(2-methylpropanoylamino)-2-oxopyrimidin-1-yl]oxolan-3-yl]oxybutanedioic acid.
| Compound Name | 2-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[4-(2-methylpropanoylamino)-2-oxopyrimidin-1-yl]oxolan-3-yl]oxybutanedioic acid |
|---|---|
| PubChem CID | 71434931 |
| Molecular Formula | C38H41N3O11 |
| Molecular Weight | 715.76 g/mol |
| Exact Mass | 715.27 |
| IUPAC Name | 2-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[4-(2-methylpropanoylamino)-2-oxopyrimidin-1-yl]oxolan-3-yl]oxybutanedioic acid |
| SMILES | COc1ccc(C(OCC2OC(n3ccc(NC(=O)C(C)C)nc3=O)CC2OC(CC(=O)O)C(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H41N3O11/c1-23(2)35(44)39-32-18-19-41(37(47)40-32)33-20-29(51-30(36(45)46)21-34(42)43)31(52-33)22-50-38(24-8-6-5-7-9-24,25-10-14-27(48-3)15-11-25)26-12-16-28(49-4)17-13-26/h5-19,23,29-31,33H,20-22H2,1-4H3,(H,42,43)(H,45,46)(H,39,40,44,47) |
| InChIKey | YBSODWQVVFRKLQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 184.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.76 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|