About 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one
4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 71464185) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one.
Analyze 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one?
The IUPAC name of 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one (CID 71464185) is 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one.
What is the SMILES notation for 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one?
The canonical SMILES for 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one is CC1CNC(=O)c2cccn21.
What is the InChIKey of 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one?
The InChIKey is NKPXFSLXXRPFKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-6-5-9-8(11)7-3-2-4-10(6)7/h2-4,6H,5H2,1H3,(H,9,11).
What are the key properties of 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one?
4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one has a molecular weight of 150.18 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one is sourced from PubChem (CID 71464185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).