C21H17ClN4O5S — CID 71466608
N-[(E)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 71466608) has the molecular formula C21H17ClN4O5S and a molecular weight of 472.91 g/mol. Its IUPAC name is N-[(E)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | N-[(E)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 71466608 |
| Molecular Formula | C21H17ClN4O5S |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | N-[(E)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | COc1ccc2cc(/C=N/NC(=O)C3=C(O)c4ccccc4S(=O)(=O)N3C)c(Cl)nc2c1 |
| InChI | InChI=1S/C21H17ClN4O5S/c1-26-18(19(27)15-5-3-4-6-17(15)32(26,29)30)21(28)25-23-11-13-9-12-7-8-14(31-2)10-16(12)24-20(13)22/h3-11,27H,1-2H3,(H,25,28)/b23-11+ |
| InChIKey | LVFNNRQUCPDBRO-FOKLQQMPSA-N |
| XLogP | 2.91 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|