C31H28O11 — CID 71482744
1,3,6,8-tetrahydroxy-2,7-dimethoxy-4-[phenyl-(2,4,5-trimethoxyphenyl)methyl]xanthen-9-one (PubChem CID 71482744) has the molecular formula C31H28O11 and a molecular weight of 576.55 g/mol. Its IUPAC name is 1,3,6,8-tetrahydroxy-2,7-dimethoxy-4-[phenyl-(2,4,5-trimethoxyphenyl)methyl]xanthen-9-one.
| Compound Name | 1,3,6,8-tetrahydroxy-2,7-dimethoxy-4-[phenyl-(2,4,5-trimethoxyphenyl)methyl]xanthen-9-one |
|---|---|
| PubChem CID | 71482744 |
| Molecular Formula | C31H28O11 |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 1,3,6,8-tetrahydroxy-2,7-dimethoxy-4-[phenyl-(2,4,5-trimethoxyphenyl)methyl]xanthen-9-one |
| SMILES | COc1cc(OC)c(C(c2ccccc2)c2c(O)c(OC)c(O)c3c(=O)c4c(O)c(OC)c(O)cc4oc23)cc1OC |
| InChI | InChI=1S/C31H28O11/c1-37-17-13-19(39-3)18(38-2)11-15(17)21(14-9-7-6-8-10-14)23-27(35)31(41-5)28(36)24-25(33)22-20(42-30(23)24)12-16(32)29(40-4)26(22)34/h6-13,21,32,34-36H,1-5H3 |
| InChIKey | DBIPPHQXGXTCPX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|