C31H36O6 — CID 71598419
1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbutyl)-6-phenylmethoxyxanthen-9-one (PubChem CID 71598419) has the molecular formula C31H36O6 and a molecular weight of 504.62 g/mol. Its IUPAC name is 1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbutyl)-6-phenylmethoxyxanthen-9-one.
| Compound Name | 1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbutyl)-6-phenylmethoxyxanthen-9-one |
|---|---|
| PubChem CID | 71598419 |
| Molecular Formula | C31H36O6 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbutyl)-6-phenylmethoxyxanthen-9-one |
| SMILES | COc1c(OCc2ccccc2)cc2oc3cc(O)c(CCC(C)C)c(O)c3c(=O)c2c1CCC(C)C |
| InChI | InChI=1S/C31H36O6/c1-18(2)11-13-21-23(32)15-24-28(29(21)33)30(34)27-22(14-12-19(3)4)31(35-5)26(16-25(27)37-24)36-17-20-9-7-6-8-10-20/h6-10,15-16,18-19,32-33H,11-14,17H2,1-5H3 |
| InChIKey | VENKSAFIEOVGLN-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|