C26H34O7 — CID 71598211
1,3-dihydroxy-6-(2-hydroxyethoxy)-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one (PubChem CID 71598211) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is 1,3-dihydroxy-6-(2-hydroxyethoxy)-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one.
| Compound Name | 1,3-dihydroxy-6-(2-hydroxyethoxy)-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one |
|---|---|
| PubChem CID | 71598211 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 1,3-dihydroxy-6-(2-hydroxyethoxy)-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one |
| SMILES | COc1c(OCCO)cc2oc3cc(O)c(CCC(C)C)c(O)c3c(=O)c2c1CCC(C)C |
| InChI | InChI=1S/C26H34O7/c1-14(2)6-8-16-18(28)12-19-23(24(16)29)25(30)22-17(9-7-15(3)4)26(31-5)21(32-11-10-27)13-20(22)33-19/h12-15,27-29H,6-11H2,1-5H3 |
| InChIKey | GIURTXRGYWKAKO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|