C28H38O6 — CID 102253505
4-butyl-1,3,6-trihydroxy-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one (PubChem CID 102253505) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is 4-butyl-1,3,6-trihydroxy-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one.
| Compound Name | 4-butyl-1,3,6-trihydroxy-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one |
|---|---|
| PubChem CID | 102253505 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 4-butyl-1,3,6-trihydroxy-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one |
| SMILES | CCCCc1c(O)c(CCC(C)C)c(O)c2c(=O)c3c(CCC(C)C)c(OC)c(O)cc3oc12 |
| InChI | InChI=1S/C28H38O6/c1-7-8-9-19-24(30)18(13-11-16(4)5)25(31)23-26(32)22-17(12-10-15(2)3)27(33-6)20(29)14-21(22)34-28(19)23/h14-16,29-31H,7-13H2,1-6H3 |
| InChIKey | LDLWZVRYFKORRM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|