C26H34O6 — CID 71520854
6-ethoxy-1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one (PubChem CID 71520854) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is 6-ethoxy-1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one.
| Compound Name | 6-ethoxy-1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one |
|---|---|
| PubChem CID | 71520854 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 6-ethoxy-1,3-dihydroxy-7-methoxy-2,8-bis(3-methylbutyl)xanthen-9-one |
| SMILES | CCOc1cc2oc3cc(O)c(CCC(C)C)c(O)c3c(=O)c2c(CCC(C)C)c1OC |
| InChI | InChI=1S/C26H34O6/c1-7-31-21-13-20-22(17(26(21)30-6)11-9-15(4)5)25(29)23-19(32-20)12-18(27)16(24(23)28)10-8-14(2)3/h12-15,27-28H,7-11H2,1-6H3 |
| InChIKey | KLNTUDNJECFMME-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|