C7H5F3N2O4S2 — CID 71516518
6,7-dihydro-[1,4]oxathiino[2,3-c]pyridazin-3-yl trifluoromethanesulfonate (PubChem CID 71516518) has the molecular formula C7H5F3N2O4S2 and a molecular weight of 302.26 g/mol. Its IUPAC name is 6,7-dihydro-[1,4]oxathiino[2,3-c]pyridazin-3-yl trifluoromethanesulfonate.
| Compound Name | 6,7-dihydro-[1,4]oxathiino[2,3-c]pyridazin-3-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 71516518 |
| Molecular Formula | C7H5F3N2O4S2 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 6,7-dihydro-[1,4]oxathiino[2,3-c]pyridazin-3-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c(nn1)OCCS2)C(F)(F)F |
| InChI | InChI=1S/C7H5F3N2O4S2/c8-7(9,10)18(13,14)16-5-3-4-6(12-11-5)15-1-2-17-4/h3H,1-2H2 |
| InChIKey | WCFHIRCLPMDZMJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|