C31H44O6Si — CID 71537128
2-[(2R,3S,4aR,6S,7R,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetaldehyde (PubChem CID 71537128) has the molecular formula C31H44O6Si and a molecular weight of 540.77 g/mol. Its IUPAC name is 2-[(2R,3S,4aR,6S,7R,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetaldehyde.
| Compound Name | 2-[(2R,3S,4aR,6S,7R,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 71537128 |
| Molecular Formula | C31H44O6Si |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 2-[(2R,3S,4aR,6S,7R,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-2-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)C[C@H]2O[C@H]1CC=O |
| InChI | InChI=1S/C31H44O6Si/c1-31(2,3)38(4,5)37-29-19-28-27(35-25(29)16-17-32)18-26(34-21-24-14-10-7-11-15-24)30(36-28)22-33-20-23-12-8-6-9-13-23/h6-15,17,25-30H,16,18-22H2,1-5H3/t25-,26-,27+,28-,29+,30+/m0/s1 |
| InChIKey | MRQUTSBIJJPNQL-KYXGADQASA-N |
| XLogP | 6.08 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|