C25H38O3 — CID 71577242
(4S,5R)-4-hydroxy-5-[(4R,5E,9E)-4-hydroxy-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl]-2-methylcyclohex-2-en-1-one (PubChem CID 71577242) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (4S,5R)-4-hydroxy-5-[(4R,5E,9E)-4-hydroxy-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl]-2-methylcyclohex-2-en-1-one.
| Compound Name | (4S,5R)-4-hydroxy-5-[(4R,5E,9E)-4-hydroxy-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl]-2-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 71577242 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (4S,5R)-4-hydroxy-5-[(4R,5E,9E)-4-hydroxy-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl]-2-methylcyclohex-2-en-1-one |
| SMILES | C=C(C[C@@H](O)/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@H]1CC(=O)C(C)=C[C@@H]1O |
| InChI | InChI=1S/C25H38O3/c1-17(2)9-7-10-18(3)11-8-12-19(4)13-22(26)14-20(5)23-16-24(27)21(6)15-25(23)28/h9,11,13,15,22-23,25-26,28H,5,7-8,10,12,14,16H2,1-4,6H3/b18-11+,19-13+/t22-,23+,25-/m0/s1 |
| InChIKey | QDIVBOSSFQXZDN-DQOLFDOOSA-N |
| XLogP | 5.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|