C34H44N2O4Si — CID 71578329
methyl (1R,12S,19S)-8-benzyl-12-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-15-oxo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate (PubChem CID 71578329) has the molecular formula C34H44N2O4Si and a molecular weight of 572.82 g/mol. Its IUPAC name is methyl (1R,12S,19S)-8-benzyl-12-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-15-oxo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate.
| Compound Name | methyl (1R,12S,19S)-8-benzyl-12-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-15-oxo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 71578329 |
| Molecular Formula | C34H44N2O4Si |
| Molecular Weight | 572.82 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | methyl (1R,12S,19S)-8-benzyl-12-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-15-oxo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate |
| SMILES | COC(=O)C1=C2N(Cc3ccccc3)c3ccccc3[C@@]23CCN2C(=O)CC[C@@](CCO[Si](C)(C)C(C)(C)C)(C1)[C@H]23 |
| InChI | InChI=1S/C34H44N2O4Si/c1-32(2,3)41(5,6)40-21-19-33-17-16-28(37)35-20-18-34(31(33)35)26-14-10-11-15-27(26)36(23-24-12-8-7-9-13-24)29(34)25(22-33)30(38)39-4/h7-15,31H,16-23H2,1-6H3/t31-,33+,34-/m0/s1 |
| InChIKey | RKEQJKSQROVJQU-IGOOQNSHSA-N |
| XLogP | 6.57 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.82 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|