C17H21F2NO2 — CID 71582298
2,2-difluoro-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 71582298) has the molecular formula C17H21F2NO2 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2,2-difluoro-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 71582298 |
| Molecular Formula | C17H21F2NO2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2,2-difluoro-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | CC1=C(CNc2ccc3c(c2)OC(F)(F)O3)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H21F2NO2/c1-11-5-4-8-16(2,3)13(11)10-20-12-6-7-14-15(9-12)22-17(18,19)21-14/h6-7,9,20H,4-5,8,10H2,1-3H3 |
| InChIKey | MAGZXMFUBOEZJP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|