C25H22N4O4 — CID 71595905
benzyl N-[(1S)-1-[2-(4-nitrophenyl)-1H-imidazol-5-yl]-2-phenylethyl]carbamate (PubChem CID 71595905) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[2-(4-nitrophenyl)-1H-imidazol-5-yl]-2-phenylethyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[2-(4-nitrophenyl)-1H-imidazol-5-yl]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 71595905 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | benzyl N-[(1S)-1-[2-(4-nitrophenyl)-1H-imidazol-5-yl]-2-phenylethyl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)c1cnc(-c2ccc([N+](=O)[O-])cc2)[nH]1)OCc1ccccc1 |
| InChI | InChI=1S/C25H22N4O4/c30-25(33-17-19-9-5-2-6-10-19)28-22(15-18-7-3-1-4-8-18)23-16-26-24(27-23)20-11-13-21(14-12-20)29(31)32/h1-14,16,22H,15,17H2,(H,26,27)(H,28,30)/t22-/m0/s1 |
| InChIKey | RLTMPUIYQPOSTK-QFIPXVFZSA-N |
| XLogP | 5.20 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|