C17H27BBrCl2NO2 — CID 71607734
bis(2-chloroethyl)-methyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azanium bromide (PubChem CID 71607734) has the molecular formula C17H27BBrCl2NO2 and a molecular weight of 439.03 g/mol. Its IUPAC name is bis(2-chloroethyl)-methyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azanium bromide.
| Compound Name | bis(2-chloroethyl)-methyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azanium bromide |
|---|---|
| PubChem CID | 71607734 |
| Molecular Formula | C17H27BBrCl2NO2 |
| Molecular Weight | 439.03 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | bis(2-chloroethyl)-methyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azanium bromide |
| SMILES | CC1(C)OB(c2ccc([N+](C)(CCCl)CCCl)cc2)OC1(C)C.[Br-] |
| InChI | InChI=1S/C17H27BCl2NO2.BrH/c1-16(2)17(3,4)23-18(22-16)14-6-8-15(9-7-14)21(5,12-10-19)13-11-20;/h6-9H,10-13H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | RKGMDYMYPNJLAX-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.03 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|