C27H29N5O3 — CID 71616032
7-[3-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 71616032) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 7-[3-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 7-[3-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 71616032 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 7-[3-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OCCCN4CCC5(CCNC5=O)C4)cc23)c1 |
| InChI | InChI=1S/C27H29N5O3/c1-3-19-6-4-7-20(14-19)31-25-21-15-24(23(34-2)16-22(21)29-18-30-25)35-13-5-11-32-12-9-27(17-32)8-10-28-26(27)33/h1,4,6-7,14-16,18H,5,8-13,17H2,2H3,(H,28,33)(H,29,30,31) |
| InChIKey | KXYSPTMYTYXONL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|