C27H29N5O4 — CID 71617440
7-[3-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-3-methyl-1-oxa-3,7-diazaspiro[4.4]nonan-2-one (PubChem CID 71617440) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is 7-[3-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-3-methyl-1-oxa-3,7-diazaspiro[4.4]nonan-2-one.
| Compound Name | 7-[3-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-3-methyl-1-oxa-3,7-diazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 71617440 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 7-[3-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-3-methyl-1-oxa-3,7-diazaspiro[4.4]nonan-2-one |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OCCCN4CCC5(C4)CN(C)C(=O)O5)cc23)c1 |
| InChI | InChI=1S/C27H29N5O4/c1-4-19-7-5-8-20(13-19)30-25-21-14-24(23(34-3)15-22(21)28-18-29-25)35-12-6-10-32-11-9-27(17-32)16-31(2)26(33)36-27/h1,5,7-8,13-15,18H,6,9-12,16-17H2,2-3H3,(H,28,29,30) |
| InChIKey | NMIBDECITOSTOT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|