C24H25N3O5S — CID 71660532
2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]pyrano[2,3-g][1,3]benzothiazol-7-one (PubChem CID 71660532) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is 2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]pyrano[2,3-g][1,3]benzothiazol-7-one.
| Compound Name | 2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]pyrano[2,3-g][1,3]benzothiazol-7-one |
|---|---|
| PubChem CID | 71660532 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]pyrano[2,3-g][1,3]benzothiazol-7-one |
| SMILES | COc1ccc(CN2CCN(c3nc4ccc5oc(=O)ccc5c4s3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C24H25N3O5S/c1-29-19-7-4-15(21(30-2)22(19)31-3)14-26-10-12-27(13-11-26)24-25-17-6-8-18-16(23(17)33-24)5-9-20(28)32-18/h4-9H,10-14H2,1-3H3 |
| InChIKey | HNIOCYHYWNYCAL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 77.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|