C39H40ClN2O6+ — CID 71668061
ethyl 4-[8'-chloro-9'-(4-hydroxy-N-methylanilino)-2',2',4'-trimethyl-3-oxospiro[2-benzofuran-1,6'-4,5a-dihydro-3H-chromeno[3,2-g]quinolin-1-ium]-1'-yl]butanoate (PubChem CID 71668061) has the molecular formula C39H40ClN2O6+ and a molecular weight of 668.21 g/mol. Its IUPAC name is ethyl 4-[8'-chloro-9'-(4-hydroxy-N-methylanilino)-2',2',4'-trimethyl-3-oxospiro[2-benzofuran-1,6'-4,5a-dihydro-3H-chromeno[3,2-g]quinolin-1-ium]-1'-yl]butanoate.
| Compound Name | ethyl 4-[8'-chloro-9'-(4-hydroxy-N-methylanilino)-2',2',4'-trimethyl-3-oxospiro[2-benzofuran-1,6'-4,5a-dihydro-3H-chromeno[3,2-g]quinolin-1-ium]-1'-yl]butanoate |
|---|---|
| PubChem CID | 71668061 |
| Molecular Formula | C39H40ClN2O6+ |
| Molecular Weight | 668.21 g/mol |
| Exact Mass | 667.26 |
| IUPAC Name | ethyl 4-[8'-chloro-9'-(4-hydroxy-N-methylanilino)-2',2',4'-trimethyl-3-oxospiro[2-benzofuran-1,6'-4,5a-dihydro-3H-chromeno[3,2-g]quinolin-1-ium]-1'-yl]butanoate |
| SMILES | CCOC(=O)CCC[N+]1=C2C=C3Oc4cc(N(C)c5ccc(O)cc5)c(Cl)cc4C4(OC(=O)c5ccccc54)C3C=C2C(C)CC1(C)C |
| InChI | InChI=1S/C39H39ClN2O6/c1-6-46-36(44)12-9-17-42-32-20-34-29(18-27(32)23(2)22-38(42,3)4)39(28-11-8-7-10-26(28)37(45)48-39)30-19-31(40)33(21-35(30)47-34)41(5)24-13-15-25(43)16-14-24/h7-8,10-11,13-16,18-21,23,29H,6,9,12,17,22H2,1-5H3/p+1 |
| InChIKey | HGEMXACOMHCODV-UHFFFAOYSA-O |
| XLogP | 7.68 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.21 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|