C24H24NO5+ — CID 58797704
3-(6'-methoxy-3-oxospiro[2-benzofuran-1,9'-6,8a-dihydroxanthene]-3'-yl)oxypropylazanium (PubChem CID 58797704) has the molecular formula C24H24NO5+ and a molecular weight of 406.46 g/mol. Its IUPAC name is 3-(6'-methoxy-3-oxospiro[2-benzofuran-1,9'-6,8a-dihydroxanthene]-3'-yl)oxypropylazanium.
| Compound Name | 3-(6'-methoxy-3-oxospiro[2-benzofuran-1,9'-6,8a-dihydroxanthene]-3'-yl)oxypropylazanium |
|---|---|
| PubChem CID | 58797704 |
| Molecular Formula | C24H24NO5+ |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-(6'-methoxy-3-oxospiro[2-benzofuran-1,9'-6,8a-dihydroxanthene]-3'-yl)oxypropylazanium |
| SMILES | COC1C=CC2C(=C1)Oc1cc(OCCC[NH3+])ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H23NO5/c1-27-15-7-9-19-21(13-15)29-22-14-16(28-12-4-11-25)8-10-20(22)24(19)18-6-3-2-5-17(18)23(26)30-24/h2-3,5-10,13-15,19H,4,11-12,25H2,1H3/p+1 |
| InChIKey | SJDRBFFAKCYWGZ-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|