C19H24N2O8S — CID 71713662
N-(2,2-dimethoxyethyl)-N-[(2,5-dimethoxyphenyl)methyl]-2-nitrobenzenesulfonamide (PubChem CID 71713662) has the molecular formula C19H24N2O8S and a molecular weight of 440.47 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-[(2,5-dimethoxyphenyl)methyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-[(2,5-dimethoxyphenyl)methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 71713662 |
| Molecular Formula | C19H24N2O8S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-[(2,5-dimethoxyphenyl)methyl]-2-nitrobenzenesulfonamide |
| SMILES | COc1ccc(OC)c(CN(CC(OC)OC)S(=O)(=O)c2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H24N2O8S/c1-26-15-9-10-17(27-2)14(11-15)12-20(13-19(28-3)29-4)30(24,25)18-8-6-5-7-16(18)21(22)23/h5-11,19H,12-13H2,1-4H3 |
| InChIKey | DQVNHAYFMWOGRV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|