C19H21NO3 — CID 71728548
8-(4-methoxyphenyl)-1-propan-2-yl-5H-4,1-benzoxazepin-2-one (PubChem CID 71728548) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-1-propan-2-yl-5H-4,1-benzoxazepin-2-one.
| Compound Name | 8-(4-methoxyphenyl)-1-propan-2-yl-5H-4,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 71728548 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 8-(4-methoxyphenyl)-1-propan-2-yl-5H-4,1-benzoxazepin-2-one |
| SMILES | COc1ccc(-c2ccc3c(c2)N(C(C)C)C(=O)COC3)cc1 |
| InChI | InChI=1S/C19H21NO3/c1-13(2)20-18-10-15(14-6-8-17(22-3)9-7-14)4-5-16(18)11-23-12-19(20)21/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | YPPGZEUAUAJWOI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |