C11H19ClFN6O12P3 — CID 71761562
[[(2R,3R,4R,5R)-2-(chloromethyl)-5-(2,6-diamino-4,5-dihydropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 71761562) has the molecular formula C11H19ClFN6O12P3 and a molecular weight of 574.68 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-2-(chloromethyl)-5-(2,6-diamino-4,5-dihydropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-2-(chloromethyl)-5-(2,6-diamino-4,5-dihydropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 71761562 |
| Molecular Formula | C11H19ClFN6O12P3 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 573.99 |
| IUPAC Name | [[(2R,3R,4R,5R)-2-(chloromethyl)-5-(2,6-diamino-4,5-dihydropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC1=NC2C(N=CN2[C@@H]2O[C@](CCl)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2F)C(N)=N1 |
| InChI | InChI=1S/C11H19ClFN6O12P3/c12-1-11(2-28-33(24,25)31-34(26,27)30-32(21,22)23)6(20)4(13)9(29-11)19-3-16-5-7(14)17-10(15)18-8(5)19/h3-6,8-9,20H,1-2H2,(H,24,25)(H,26,27)(H2,21,22,23)(H4,14,15,17,18)/t4-,5?,6+,8?,9-,11-/m1/s1 |
| InChIKey | FRNLLCFXSIZBPP-SOUDLAKISA-N |
| XLogP | -1.91 |
| TPSA | 281.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|