C11H20N5O13P3 — CID 89495429
[[(2R,4S,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 89495429) has the molecular formula C11H20N5O13P3 and a molecular weight of 523.23 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 89495429 |
| Molecular Formula | C11H20N5O13P3 |
| Molecular Weight | 523.23 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | [[(2R,4S,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](N2C=NC3C(N)=NC=NC32)[C@@H](O)C1O |
| InChI | InChI=1S/C11H20N5O13P3/c1-11(2-26-31(22,23)29-32(24,25)28-30(19,20)21)7(18)6(17)10(27-11)16-4-15-5-8(12)13-3-14-9(5)16/h3-7,9-10,17-18H,2H2,1H3,(H,22,23)(H,24,25)(H2,12,13,14)(H2,19,20,21)/t5?,6-,7?,9?,10+,11+/m0/s1 |
| InChIKey | XTOMAPMSNAXYJN-FWEJQQKISA-N |
| XLogP | -2.40 |
| TPSA | 275.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.23 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|