C9H20N3O13P3 — CID 123440071
[[5-[(3-amino-3-iminopropylidene)amino]-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123440071) has the molecular formula C9H20N3O13P3 and a molecular weight of 471.19 g/mol. Its IUPAC name is [[5-[(3-amino-3-iminopropylidene)amino]-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-[(3-amino-3-iminopropylidene)amino]-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123440071 |
| Molecular Formula | C9H20N3O13P3 |
| Molecular Weight | 471.19 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | [[5-[(3-amino-3-iminopropylidene)amino]-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [H]/N=C(\N)CC=NC1OC(C)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C9H20N3O13P3/c1-9(7(14)6(13)8(23-9)12-3-2-5(10)11)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h3,6-8,13-14H,2,4H2,1H3,(H3,10,11)(H,18,19)(H,20,21)(H2,15,16,17) |
| InChIKey | UANOCOTYQLDKOZ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 271.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.19 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|