C29H53F3O5Si2 — CID 71762549
methyl (E,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-7,7,7-trifluoro-6-hydroxyhept-1-enyl]cyclopentyl]but-2-enoate (PubChem CID 71762549) has the molecular formula C29H53F3O5Si2 and a molecular weight of 594.90 g/mol. Its IUPAC name is methyl (E,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-7,7,7-trifluoro-6-hydroxyhept-1-enyl]cyclopentyl]but-2-enoate.
| Compound Name | methyl (E,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-7,7,7-trifluoro-6-hydroxyhept-1-enyl]cyclopentyl]but-2-enoate |
|---|---|
| PubChem CID | 71762549 |
| Molecular Formula | C29H53F3O5Si2 |
| Molecular Weight | 594.90 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | methyl (E,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-7,7,7-trifluoro-6-hydroxyhept-1-enyl]cyclopentyl]but-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1/C=C/CCCC(O)C(F)(F)F |
| InChI | InChI=1S/C29H53F3O5Si2/c1-27(2,3)38(8,9)36-22-19-21(15-13-12-14-16-25(33)29(30,31)32)23(20-22)24(17-18-26(34)35-7)37-39(10,11)28(4,5)6/h13,15,17-18,21-25,33H,12,14,16,19-20H2,1-11H3/b15-13+,18-17+/t21-,22+,23-,24-,25?/m1/s1 |
| InChIKey | GVLHVZZAEJECQT-MOJFUGPKSA-N |
| XLogP | 8.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.90 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|